C30H48N6O8P — CID 102089075
CID 102089075 (PubChem CID 102089075) has the molecular formula C30H48N6O8P and a molecular weight of 651.72 g/mol.
| Compound Name | CID 102089075 |
|---|---|
| PubChem CID | 102089075 |
| Molecular Formula | C30H48N6O8P |
| Molecular Weight | 651.72 g/mol |
| Exact Mass | 651.33 |
| IUPAC Name | — |
| SMILES | CC(C)N(C(C)C)P(OCCC#N)O[C@H]1C[C@H](n2cc(/C=C/C(=O)NC3CC(C)(C)N([O])C(C)(C)C3)c(=O)[nH]c2=O)O[C@@H]1CO |
| InChI | InChI=1S/C30H48N6O8P/c1-19(2)35(20(3)4)45(42-13-9-12-31)44-23-14-26(43-24(23)18-37)34-17-21(27(39)33-28(34)40)10-11-25(38)32-22-15-29(5,6)36(41)30(7,8)16-22/h10-11,17,19-20,22-24,26,37H,9,13-16,18H2,1-8H3,(H,32,38)(H,33,39,40)/b11-10+/t23-,24+,26+,45?/m0/s1 |
| InChIKey | YMHHNPQDJJTWJW-PVMHJVLFSA-N |
| XLogP | 2.97 |
| TPSA | 182.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.72 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|