C56H36N4 — CID 161428750
2,4-bis(2,3,4,5,6-pentadeuteriophenyl)benzo[h]quinazoline;2-naphthalen-1-yl-4-naphthalen-2-ylbenzo[h]quinazoline (PubChem CID 161428750) has the molecular formula C56H36N4 and a molecular weight of 774.99 g/mol. Its IUPAC name is 2,4-bis(2,3,4,5,6-pentadeuteriophenyl)benzo[h]quinazoline;2-naphthalen-1-yl-4-naphthalen-2-ylbenzo[h]quinazoline.
| Compound Name | 2,4-bis(2,3,4,5,6-pentadeuteriophenyl)benzo[h]quinazoline;2-naphthalen-1-yl-4-naphthalen-2-ylbenzo[h]quinazoline |
|---|---|
| PubChem CID | 161428750 |
| Molecular Formula | C56H36N4 |
| Molecular Weight | 774.99 g/mol |
| Exact Mass | 774.36 |
| IUPAC Name | 2,4-bis(2,3,4,5,6-pentadeuteriophenyl)benzo[h]quinazoline;2-naphthalen-1-yl-4-naphthalen-2-ylbenzo[h]quinazoline |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])c3ccc4ccccc4c3n2)c([2H])c1[2H].c1ccc2cc(-c3nc(-c4cccc5ccccc45)nc4c3ccc3ccccc34)ccc2c1 |
| InChI | InChI=1S/C32H20N2.C24H16N2/c1-2-11-24-20-25(17-16-21(24)8-1)30-29-19-18-23-10-4-6-14-27(23)31(29)34-32(33-30)28-15-7-12-22-9-3-5-13-26(22)28;1-3-10-18(11-4-1)22-21-16-15-17-9-7-8-14-20(17)23(21)26-24(25-22)19-12-5-2-6-13-19/h1-20H;1-16H/i;1D,2D,3D,4D,5D,6D,10D,11D,12D,13D |
| InChIKey | VXSLFBMHHAZPIQ-PJJROYTESA-N |
| XLogP | 14.54 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.99 |
| LogP ≤ 5 | 14.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|