C29H23N3O3 — CID 161446124
[4-(4-anilinoquinazolin-6-yl)-2-methoxyphenyl] 2-phenylacetate (PubChem CID 161446124) has the molecular formula C29H23N3O3 and a molecular weight of 461.52 g/mol. Its IUPAC name is [4-(4-anilinoquinazolin-6-yl)-2-methoxyphenyl] 2-phenylacetate.
| Compound Name | [4-(4-anilinoquinazolin-6-yl)-2-methoxyphenyl] 2-phenylacetate |
|---|---|
| PubChem CID | 161446124 |
| Molecular Formula | C29H23N3O3 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | [4-(4-anilinoquinazolin-6-yl)-2-methoxyphenyl] 2-phenylacetate |
| SMILES | COc1cc(-c2ccc3ncnc(Nc4ccccc4)c3c2)ccc1OC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C29H23N3O3/c1-34-27-18-22(13-15-26(27)35-28(33)16-20-8-4-2-5-9-20)21-12-14-25-24(17-21)29(31-19-30-25)32-23-10-6-3-7-11-23/h2-15,17-19H,16H2,1H3,(H,30,31,32) |
| InChIKey | VZXIZRQPTBKIRH-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|