C37H43F5O7S2 — CID 161454845
3-(2-bicyclo[2.2.1]heptanyl)-1,1,1-trifluoro-2-methylpropan-2-ol;1,1-difluoro-2-(2-methoxycarbonylprop-2-enoxy)ethanesulfonate;(4-methylphenyl)-diphenylsulfanium (PubChem CID 161454845) has the molecular formula C37H43F5O7S2 and a molecular weight of 758.87 g/mol. Its IUPAC name is 3-(2-bicyclo[2.2.1]heptanyl)-1,1,1-trifluoro-2-methylpropan-2-ol;1,1-difluoro-2-(2-methoxycarbonylprop-2-enoxy)ethanesulfonate;(4-methylphenyl)-diphenylsulfanium.
| Compound Name | 3-(2-bicyclo[2.2.1]heptanyl)-1,1,1-trifluoro-2-methylpropan-2-ol;1,1-difluoro-2-(2-methoxycarbonylprop-2-enoxy)ethanesulfonate;(4-methylphenyl)-diphenylsulfanium |
|---|---|
| PubChem CID | 161454845 |
| Molecular Formula | C37H43F5O7S2 |
| Molecular Weight | 758.87 g/mol |
| Exact Mass | 758.24 |
| IUPAC Name | 3-(2-bicyclo[2.2.1]heptanyl)-1,1,1-trifluoro-2-methylpropan-2-ol;1,1-difluoro-2-(2-methoxycarbonylprop-2-enoxy)ethanesulfonate;(4-methylphenyl)-diphenylsulfanium |
| SMILES | C=C(COCC(F)(F)S(=O)(=O)[O-])C(=O)OC.CC(O)(CC1CC2CCC1C2)C(F)(F)F.Cc1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H17S.C11H17F3O.C7H10F2O6S/c1-16-12-14-19(15-13-16)20(17-8-4-2-5-9-17)18-10-6-3-7-11-18;1-10(15,11(12,13)14)6-9-5-7-2-3-8(9)4-7;1-5(6(10)14-2)3-15-4-7(8,9)16(11,12)13/h2-15H,1H3;7-9,15H,2-6H2,1H3;1,3-4H2,2H3,(H,11,12,13)/q+1;;/p-1 |
| InChIKey | WBACRAUMDZWQPZ-UHFFFAOYSA-M |
| XLogP | 8.09 |
| TPSA | 112.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.87 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|