C8H12F8 — CID 161475388
methane;1,1,1,2,3,3,5,5-octafluoro-2-methylhexane (PubChem CID 161475388) has the molecular formula C8H12F8 and a molecular weight of 260.17 g/mol. Its IUPAC name is methane;1,1,1,2,3,3,5,5-octafluoro-2-methylhexane.
| Compound Name | methane;1,1,1,2,3,3,5,5-octafluoro-2-methylhexane |
|---|---|
| PubChem CID | 161475388 |
| Molecular Formula | C8H12F8 |
| Molecular Weight | 260.17 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | methane;1,1,1,2,3,3,5,5-octafluoro-2-methylhexane |
| SMILES | C.CC(F)(F)CC(F)(F)C(C)(F)C(F)(F)F |
| InChI | InChI=1S/C7H8F8.CH4/c1-4(8,9)3-6(11,12)5(2,10)7(13,14)15;/h3H2,1-2H3;1H4 |
| InChIKey | WDQHHGWBHAYAPL-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.17 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |