C34H42IN6O13P — CID 161484982
[1-[2-[4-(6-iodoimidazo[1,2-a]pyridin-2-yl)-N-methylanilino]ethyl]triazol-4-yl]methyl 4-[2-[4-[2,3-diformyloxypropoxy(hydroxy)phosphoryl]oxybutanoyloxy]ethoxy]butanoate (PubChem CID 161484982) has the molecular formula C34H42IN6O13P and a molecular weight of 900.62 g/mol. Its IUPAC name is [1-[2-[4-(6-iodoimidazo[1,2-a]pyridin-2-yl)-N-methylanilino]ethyl]triazol-4-yl]methyl 4-[2-[4-[2,3-diformyloxypropoxy(hydroxy)phosphoryl]oxybutanoyloxy]ethoxy]butanoate.
| Compound Name | [1-[2-[4-(6-iodoimidazo[1,2-a]pyridin-2-yl)-N-methylanilino]ethyl]triazol-4-yl]methyl 4-[2-[4-[2,3-diformyloxypropoxy(hydroxy)phosphoryl]oxybutanoyloxy]ethoxy]butanoate |
|---|---|
| PubChem CID | 161484982 |
| Molecular Formula | C34H42IN6O13P |
| Molecular Weight | 900.62 g/mol |
| Exact Mass | 900.16 |
| IUPAC Name | [1-[2-[4-(6-iodoimidazo[1,2-a]pyridin-2-yl)-N-methylanilino]ethyl]triazol-4-yl]methyl 4-[2-[4-[2,3-diformyloxypropoxy(hydroxy)phosphoryl]oxybutanoyloxy]ethoxy]butanoate |
| SMILES | CN(CCn1cc(COC(=O)CCCOCCOC(=O)CCCOP(=O)(O)OCC(COC=O)OC=O)nn1)c1ccc(-c2cn3cc(I)ccc3n2)cc1 |
| InChI | InChI=1S/C34H42IN6O13P/c1-39(29-9-6-26(7-10-29)31-20-40-18-27(35)8-11-32(40)36-31)12-13-41-19-28(37-38-41)21-51-34(45)4-2-14-48-16-17-50-33(44)5-3-15-53-55(46,47)54-23-30(52-25-43)22-49-24-42/h6-11,18-20,24-25,30H,2-5,12-17,21-23H2,1H3,(H,46,47) |
| InChIKey | RESODQKYYHYZAC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 221.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 900.62 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|