C13H34N4O2 — CID 161491440
N-(6-aminohexyl)carbamate;hexane-1,6-diamine;hydron;molecular hydrogen (PubChem CID 161491440) has the molecular formula C13H34N4O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is N-(6-aminohexyl)carbamate;hexane-1,6-diamine;hydron;molecular hydrogen.
| Compound Name | N-(6-aminohexyl)carbamate;hexane-1,6-diamine;hydron;molecular hydrogen |
|---|---|
| PubChem CID | 161491440 |
| Molecular Formula | C13H34N4O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.27 |
| IUPAC Name | N-(6-aminohexyl)carbamate;hexane-1,6-diamine;hydron;molecular hydrogen |
| SMILES | NCCCCCCN.NCCCCCCNC(=O)[O-].[H+].[H][H] |
| InChI | InChI=1S/C7H16N2O2.C6H16N2.H2/c8-5-3-1-2-4-6-9-7(10)11;7-5-3-1-2-4-6-8;/h9H,1-6,8H2,(H,10,11);1-8H2;1H |
| InChIKey | WFQTWVKTDJKCLL-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 130.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|