C21H27N2O2S+ — CID 161496582
(1-ethyl-9-methylphenothiazin-3-ylidene)-bis(2-methoxyethyl)azanium (PubChem CID 161496582) has the molecular formula C21H27N2O2S+ and a molecular weight of 371.53 g/mol. Its IUPAC name is (1-ethyl-9-methylphenothiazin-3-ylidene)-bis(2-methoxyethyl)azanium.
| Compound Name | (1-ethyl-9-methylphenothiazin-3-ylidene)-bis(2-methoxyethyl)azanium |
|---|---|
| PubChem CID | 161496582 |
| Molecular Formula | C21H27N2O2S+ |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | (1-ethyl-9-methylphenothiazin-3-ylidene)-bis(2-methoxyethyl)azanium |
| SMILES | CCc1cc(=[N+](CCOC)CCOC)cc2sc3cccc(C)c3nc1-2 |
| InChI | InChI=1S/C21H27N2O2S/c1-5-16-13-17(23(9-11-24-3)10-12-25-4)14-19-21(16)22-20-15(2)7-6-8-18(20)26-19/h6-8,13-14H,5,9-12H2,1-4H3/q+1 |
| InChIKey | DWYYDOCLXKBVMQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|