C19H40B2O4 — CID 162014377
2-tert-butyl-5,5-dimethyl-1,3,2-dioxaborinane;2-tert-butyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 162014377) has the molecular formula C19H40B2O4 and a molecular weight of 354.15 g/mol. Its IUPAC name is 2-tert-butyl-5,5-dimethyl-1,3,2-dioxaborinane;2-tert-butyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-tert-butyl-5,5-dimethyl-1,3,2-dioxaborinane;2-tert-butyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 162014377 |
| Molecular Formula | C19H40B2O4 |
| Molecular Weight | 354.15 g/mol |
| Exact Mass | 354.31 |
| IUPAC Name | 2-tert-butyl-5,5-dimethyl-1,3,2-dioxaborinane;2-tert-butyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC(C)(C)B1OC(C)(C)C(C)(C)O1.CC1(C)COB(C(C)(C)C)OC1 |
| InChI | InChI=1S/C10H21BO2.C9H19BO2/c1-8(2,3)11-12-9(4,5)10(6,7)13-11;1-8(2,3)10-11-6-9(4,5)7-12-10/h1-7H3;6-7H2,1-5H3 |
| InChIKey | YTXCNUXOESWEKG-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.15 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|