C20H20BrClFN — CID 162047601
6-(2-bromo-6-fluorophenyl)-3-chloro-2-methylidene-5-phenyl-3,4-dihydro-1H-pyridine;ethane (PubChem CID 162047601) has the molecular formula C20H20BrClFN and a molecular weight of 408.74 g/mol. Its IUPAC name is 6-(2-bromo-6-fluorophenyl)-3-chloro-2-methylidene-5-phenyl-3,4-dihydro-1H-pyridine;ethane.
| Compound Name | 6-(2-bromo-6-fluorophenyl)-3-chloro-2-methylidene-5-phenyl-3,4-dihydro-1H-pyridine;ethane |
|---|---|
| PubChem CID | 162047601 |
| Molecular Formula | C20H20BrClFN |
| Molecular Weight | 408.74 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | 6-(2-bromo-6-fluorophenyl)-3-chloro-2-methylidene-5-phenyl-3,4-dihydro-1H-pyridine;ethane |
| SMILES | C=C1NC(c2c(F)cccc2Br)=C(c2ccccc2)CC1Cl.CC |
| InChI | InChI=1S/C18H14BrClFN.C2H6/c1-11-15(20)10-13(12-6-3-2-4-7-12)18(22-11)17-14(19)8-5-9-16(17)21;1-2/h2-9,15,22H,1,10H2;1-2H3 |
| InChIKey | YYCJKJVFDIYDBL-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.74 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|