C15H17N — CID 158289106
3-ethenyl-5-methyl-2-methylidene-6-phenyl-3,4-dihydro-1H-pyridine (PubChem CID 158289106) has the molecular formula C15H17N and a molecular weight of 211.31 g/mol. Its IUPAC name is 3-ethenyl-5-methyl-2-methylidene-6-phenyl-3,4-dihydro-1H-pyridine.
| Compound Name | 3-ethenyl-5-methyl-2-methylidene-6-phenyl-3,4-dihydro-1H-pyridine |
|---|---|
| PubChem CID | 158289106 |
| Molecular Formula | C15H17N |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 3-ethenyl-5-methyl-2-methylidene-6-phenyl-3,4-dihydro-1H-pyridine |
| SMILES | C=CC1CC(C)=C(c2ccccc2)NC1=C |
| InChI | InChI=1S/C15H17N/c1-4-13-10-11(2)15(16-12(13)3)14-8-6-5-7-9-14/h4-9,13,16H,1,3,10H2,2H3 |
| InChIKey | GLDIFCOKZQYIHL-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|