C11H11N — CID 72537888
2-methylidene-5-phenyl-1,3-dihydropyrrole (PubChem CID 72537888) has the molecular formula C11H11N and a molecular weight of 157.22 g/mol. Its IUPAC name is 2-methylidene-5-phenyl-1,3-dihydropyrrole.
| Compound Name | 2-methylidene-5-phenyl-1,3-dihydropyrrole |
|---|---|
| PubChem CID | 72537888 |
| Molecular Formula | C11H11N |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 2-methylidene-5-phenyl-1,3-dihydropyrrole |
| SMILES | C=C1CC=C(c2ccccc2)N1 |
| InChI | InChI=1S/C11H11N/c1-9-7-8-11(12-9)10-5-3-2-4-6-10/h2-6,8,12H,1,7H2 |
| InChIKey | OMIZVLAADCFDGS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |