C24H28N2O3S — CID 162052363
1-[3-[4-[3-(aminomethyl)phenyl]piperidine-1-carbonyl]-5-methylsulfanylphenyl]butane-2,3-dione (PubChem CID 162052363) has the molecular formula C24H28N2O3S and a molecular weight of 424.57 g/mol. Its IUPAC name is 1-[3-[4-[3-(aminomethyl)phenyl]piperidine-1-carbonyl]-5-methylsulfanylphenyl]butane-2,3-dione.
| Compound Name | 1-[3-[4-[3-(aminomethyl)phenyl]piperidine-1-carbonyl]-5-methylsulfanylphenyl]butane-2,3-dione |
|---|---|
| PubChem CID | 162052363 |
| Molecular Formula | C24H28N2O3S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 1-[3-[4-[3-(aminomethyl)phenyl]piperidine-1-carbonyl]-5-methylsulfanylphenyl]butane-2,3-dione |
| SMILES | CSc1cc(CC(=O)C(C)=O)cc(C(=O)N2CCC(c3cccc(CN)c3)CC2)c1 |
| InChI | InChI=1S/C24H28N2O3S/c1-16(27)23(28)13-18-11-21(14-22(12-18)30-2)24(29)26-8-6-19(7-9-26)20-5-3-4-17(10-20)15-25/h3-5,10-12,14,19H,6-9,13,15,25H2,1-2H3 |
| InChIKey | YYSDJGUZXXEEPJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|