C42H70O3 — CID 162061519
4-(2,5,6,6-tetramethylcyclohexen-1-yl)butan-2-one;(E)-4-(2,5,6,6-tetramethylcyclohex-2-en-1-yl)but-3-en-2-one;4-(2,2,3-trimethyl-6-methylidenecyclohexyl)butan-2-one (PubChem CID 162061519) has the molecular formula C42H70O3 and a molecular weight of 623.02 g/mol. Its IUPAC name is 4-(2,5,6,6-tetramethylcyclohexen-1-yl)butan-2-one;(E)-4-(2,5,6,6-tetramethylcyclohex-2-en-1-yl)but-3-en-2-one;4-(2,2,3-trimethyl-6-methylidenecyclohexyl)butan-2-one.
| Compound Name | 4-(2,5,6,6-tetramethylcyclohexen-1-yl)butan-2-one;(E)-4-(2,5,6,6-tetramethylcyclohex-2-en-1-yl)but-3-en-2-one;4-(2,2,3-trimethyl-6-methylidenecyclohexyl)butan-2-one |
|---|---|
| PubChem CID | 162061519 |
| Molecular Formula | C42H70O3 |
| Molecular Weight | 623.02 g/mol |
| Exact Mass | 622.53 |
| IUPAC Name | 4-(2,5,6,6-tetramethylcyclohexen-1-yl)butan-2-one;(E)-4-(2,5,6,6-tetramethylcyclohex-2-en-1-yl)but-3-en-2-one;4-(2,2,3-trimethyl-6-methylidenecyclohexyl)butan-2-one |
| SMILES | C=C1CCC(C)C(C)(C)C1CCC(C)=O.CC(=O)/C=C/C1C(C)=CCC(C)C1(C)C.CC(=O)CCC1=C(C)CCC(C)C1(C)C |
| InChI | InChI=1S/2C14H24O.C14H22O/c3*1-10-6-7-11(2)14(4,5)13(10)9-8-12(3)15/h11H,6-9H2,1-5H3;11,13H,1,6-9H2,2-5H3;6,8-9,11,13H,7H2,1-5H3/b;;9-8+ |
| InChIKey | YZXDHXRHJHKRFF-AKKYVECQSA-N |
| XLogP | 11.87 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.02 |
| LogP ≤ 5 | 11.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|