C22H40O6 — CID 38359161
(2R,3R,4R,5R)-6-[(Z)-3-methyl-5-[(5S)-2,5,6,6-tetramethylcyclohexen-1-yl]pent-2-enoxy]hexane-1,2,3,4,5-pentol (PubChem CID 38359161) has the molecular formula C22H40O6 and a molecular weight of 400.56 g/mol. Its IUPAC name is (2R,3R,4R,5R)-6-[(Z)-3-methyl-5-[(5S)-2,5,6,6-tetramethylcyclohexen-1-yl]pent-2-enoxy]hexane-1,2,3,4,5-pentol.
| Compound Name | (2R,3R,4R,5R)-6-[(Z)-3-methyl-5-[(5S)-2,5,6,6-tetramethylcyclohexen-1-yl]pent-2-enoxy]hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 38359161 |
| Molecular Formula | C22H40O6 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | (2R,3R,4R,5R)-6-[(Z)-3-methyl-5-[(5S)-2,5,6,6-tetramethylcyclohexen-1-yl]pent-2-enoxy]hexane-1,2,3,4,5-pentol |
| SMILES | CC1=C(CC/C(C)=C\COC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C(C)(C)[C@@H](C)CC1 |
| InChI | InChI=1S/C22H40O6/c1-14(6-9-17-15(2)7-8-16(3)22(17,4)5)10-11-28-13-19(25)21(27)20(26)18(24)12-23/h10,16,18-21,23-27H,6-9,11-13H2,1-5H3/b14-10-/t16-,18+,19+,20+,21+/m0/s1 |
| InChIKey | CWPPKIPNSISLIX-GGYRRWSLSA-N |
| XLogP | 1.94 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|