C14H19NS — CID 162062174
(4R,5S)-5-methyl-4-phenyl-1-propan-2-ylpyrrolidine-2-thione (PubChem CID 162062174) has the molecular formula C14H19NS and a molecular weight of 233.38 g/mol. Its IUPAC name is (4R,5S)-5-methyl-4-phenyl-1-propan-2-ylpyrrolidine-2-thione.
| Compound Name | (4R,5S)-5-methyl-4-phenyl-1-propan-2-ylpyrrolidine-2-thione |
|---|---|
| PubChem CID | 162062174 |
| Molecular Formula | C14H19NS |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | (4R,5S)-5-methyl-4-phenyl-1-propan-2-ylpyrrolidine-2-thione |
| SMILES | CC(C)N1C(=S)C[C@H](c2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C14H19NS/c1-10(2)15-11(3)13(9-14(15)16)12-7-5-4-6-8-12/h4-8,10-11,13H,9H2,1-3H3/t11-,13-/m0/s1 |
| InChIKey | BXAVSBSGZQTIQN-AAEUAGOBSA-N |
| XLogP | 3.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|