C29H45BBrN5O3 — CID 162071285
2-[[5-bromo-3-[(4-methoxycyclohexyl)amino]pyrazin-2-yl]amino]acetaldehyde;2-(2-methyl(1,2,3-13C3)propan-2-yl)-5-(4,4,5,5-tetramethyloxaborolan-2-yl)pyridine (PubChem CID 162071285) has the molecular formula C29H45BBrN5O3 and a molecular weight of 607.39 g/mol. Its IUPAC name is 2-[[5-bromo-3-[(4-methoxycyclohexyl)amino]pyrazin-2-yl]amino]acetaldehyde;2-(2-methyl(1,2,3-13C3)propan-2-yl)-5-(4,4,5,5-tetramethyloxaborolan-2-yl)pyridine.
| Compound Name | 2-[[5-bromo-3-[(4-methoxycyclohexyl)amino]pyrazin-2-yl]amino]acetaldehyde;2-(2-methyl(1,2,3-13C3)propan-2-yl)-5-(4,4,5,5-tetramethyloxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 162071285 |
| Molecular Formula | C29H45BBrN5O3 |
| Molecular Weight | 607.39 g/mol |
| Exact Mass | 606.30 |
| IUPAC Name | 2-[[5-bromo-3-[(4-methoxycyclohexyl)amino]pyrazin-2-yl]amino]acetaldehyde;2-(2-methyl(1,2,3-13C3)propan-2-yl)-5-(4,4,5,5-tetramethyloxaborolan-2-yl)pyridine |
| SMILES | CC1(C)CB(c2ccc([13C](C)([13CH3])[13CH3])nc2)OC1(C)C.COC1CCC(Nc2nc(Br)cnc2N[13CH2][13CH]=O)CC1 |
| InChI | InChI=1S/C16H26BNO.C13H19BrN4O2/c1-14(2,3)13-9-8-12(10-18-13)17-11-15(4,5)16(6,7)19-17;1-20-10-4-2-9(3-5-10)17-13-12(15-6-7-19)16-8-11(14)18-13/h8-10H,11H2,1-7H3;7-10H,2-6H2,1H3,(H,15,16)(H,17,18)/i1+1,2+1,14+1;6+1,7+1 |
| InChIKey | ZBCQXDCDCOXUJQ-ZUDANFPKSA-N |
| XLogP | 5.63 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.39 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|