C31H41NNaO7+ — CID 162075299
sodium;2-(dimethylamino)ethyl (2S)-2-methoxy-3-[2-methoxy-4-[3-(4-phenoxyphenoxy)propoxy]phenyl]propanoate;methane (PubChem CID 162075299) has the molecular formula C31H41NNaO7+ and a molecular weight of 562.66 g/mol. Its IUPAC name is sodium;2-(dimethylamino)ethyl (2S)-2-methoxy-3-[2-methoxy-4-[3-(4-phenoxyphenoxy)propoxy]phenyl]propanoate;methane.
| Compound Name | sodium;2-(dimethylamino)ethyl (2S)-2-methoxy-3-[2-methoxy-4-[3-(4-phenoxyphenoxy)propoxy]phenyl]propanoate;methane |
|---|---|
| PubChem CID | 162075299 |
| Molecular Formula | C31H41NNaO7+ |
| Molecular Weight | 562.66 g/mol |
| Exact Mass | 562.28 |
| IUPAC Name | sodium;2-(dimethylamino)ethyl (2S)-2-methoxy-3-[2-methoxy-4-[3-(4-phenoxyphenoxy)propoxy]phenyl]propanoate;methane |
| SMILES | C.COc1cc(OCCCOc2ccc(Oc3ccccc3)cc2)ccc1C[C@H](OC)C(=O)OCCN(C)C.[Na+] |
| InChI | InChI=1S/C30H37NO7.CH4.Na/c1-31(2)17-20-37-30(32)29(34-4)21-23-11-12-27(22-28(23)33-3)36-19-8-18-35-24-13-15-26(16-14-24)38-25-9-6-5-7-10-25;;/h5-7,9-16,22,29H,8,17-21H2,1-4H3;1H4;/q;;+1/t29-;;/m0../s1 |
| InChIKey | AXBALNFMTJEOOS-UJXPALLWSA-N |
| XLogP | 2.64 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.66 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|