C30H37NO7 — CID 69423020
2-(dimethylamino)ethyl 2-methoxy-3-[2-methoxy-4-[3-(4-phenoxyphenoxy)propoxy]phenyl]propanoate (PubChem CID 69423020) has the molecular formula C30H37NO7 and a molecular weight of 523.63 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 2-methoxy-3-[2-methoxy-4-[3-(4-phenoxyphenoxy)propoxy]phenyl]propanoate.
| Compound Name | 2-(dimethylamino)ethyl 2-methoxy-3-[2-methoxy-4-[3-(4-phenoxyphenoxy)propoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 69423020 |
| Molecular Formula | C30H37NO7 |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 523.26 |
| IUPAC Name | 2-(dimethylamino)ethyl 2-methoxy-3-[2-methoxy-4-[3-(4-phenoxyphenoxy)propoxy]phenyl]propanoate |
| SMILES | COc1cc(OCCCOc2ccc(Oc3ccccc3)cc2)ccc1CC(OC)C(=O)OCCN(C)C |
| InChI | InChI=1S/C30H37NO7/c1-31(2)17-20-37-30(32)29(34-4)21-23-11-12-27(22-28(23)33-3)36-19-8-18-35-24-13-15-26(16-14-24)38-25-9-6-5-7-10-25/h5-7,9-16,22,29H,8,17-21H2,1-4H3 |
| InChIKey | FLZYBHURKQRCHY-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|