C52H76O4 — CID 162075869
1,4,5,8-tetratert-butylnaphthalene-2,3-dione (PubChem CID 162075869) has the molecular formula C52H76O4 and a molecular weight of 765.18 g/mol. Its IUPAC name is 1,4,5,8-tetratert-butylnaphthalene-2,3-dione.
| Compound Name | 1,4,5,8-tetratert-butylnaphthalene-2,3-dione |
|---|---|
| PubChem CID | 162075869 |
| Molecular Formula | C52H76O4 |
| Molecular Weight | 765.18 g/mol |
| Exact Mass | 764.57 |
| IUPAC Name | 1,4,5,8-tetratert-butylnaphthalene-2,3-dione |
| SMILES | CC(C)(C)C1=c2c(C(C)(C)C)ccc(C(C)(C)C)c2=C(C(C)(C)C)C(=O)C1=O.CC(C)(C)C1=c2c(C(C)(C)C)ccc(C(C)(C)C)c2=C(C(C)(C)C)C(=O)C1=O |
| InChI | InChI=1S/2C26H38O2/c2*1-23(2,3)15-13-14-16(24(4,5)6)18-17(15)19(25(7,8)9)21(27)22(28)20(18)26(10,11)12/h2*13-14H,1-12H3 |
| InChIKey | ZBRSHWTXHXXPDG-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.18 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|