C31H26N2O5 — CID 162078020
4-[[4-[4-(9H-fluoren-9-ylmethoxy)-4-oxobutyl]-2-hydroxyphenyl]diazenyl]benzoic acid (PubChem CID 162078020) has the molecular formula C31H26N2O5 and a molecular weight of 506.56 g/mol. Its IUPAC name is 4-[[4-[4-(9H-fluoren-9-ylmethoxy)-4-oxobutyl]-2-hydroxyphenyl]diazenyl]benzoic acid.
| Compound Name | 4-[[4-[4-(9H-fluoren-9-ylmethoxy)-4-oxobutyl]-2-hydroxyphenyl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 162078020 |
| Molecular Formula | C31H26N2O5 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | 4-[[4-[4-(9H-fluoren-9-ylmethoxy)-4-oxobutyl]-2-hydroxyphenyl]diazenyl]benzoic acid |
| SMILES | O=C(CCCc1ccc(/N=N/c2ccc(C(=O)O)cc2)c(O)c1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C31H26N2O5/c34-29-18-20(12-17-28(29)33-32-22-15-13-21(14-16-22)31(36)37)6-5-11-30(35)38-19-27-25-9-3-1-7-23(25)24-8-2-4-10-26(24)27/h1-4,7-10,12-18,27,34H,5-6,11,19H2,(H,36,37)/b33-32+ |
| InChIKey | ZEYRDFCGSUVFCH-ULIFNZDWSA-N |
| XLogP | 7.18 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|