C18H27ClO2Si — CID 162101194
[(1S)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-chloro-2H-naphthalen-1-yl]methanol (PubChem CID 162101194) has the molecular formula C18H27ClO2Si and a molecular weight of 338.95 g/mol. Its IUPAC name is [(1S)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-chloro-2H-naphthalen-1-yl]methanol.
| Compound Name | [(1S)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-chloro-2H-naphthalen-1-yl]methanol |
|---|---|
| PubChem CID | 162101194 |
| Molecular Formula | C18H27ClO2Si |
| Molecular Weight | 338.95 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | [(1S)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-chloro-2H-naphthalen-1-yl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@]1(CO)CC=Cc2cc(Cl)ccc21 |
| InChI | InChI=1S/C18H27ClO2Si/c1-17(2,3)22(4,5)21-13-18(12-20)10-6-7-14-11-15(19)8-9-16(14)18/h6-9,11,20H,10,12-13H2,1-5H3/t18-/m0/s1 |
| InChIKey | UBXMGVHXEIXBLZ-SFHVURJKSA-N |
| XLogP | 5.01 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.95 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|