C10H17N3O6S — CID 162104309
(2R)-2-amino-5-[[(2S)-1-(formyloxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 162104309) has the molecular formula C10H17N3O6S and a molecular weight of 307.33 g/mol. Its IUPAC name is (2R)-2-amino-5-[[(2S)-1-(formyloxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | (2R)-2-amino-5-[[(2S)-1-(formyloxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 162104309 |
| Molecular Formula | C10H17N3O6S |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | (2R)-2-amino-5-[[(2S)-1-(formyloxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | N[C@H](CCC(=O)N[C@H](CS)C(=O)NCOC=O)C(=O)O |
| InChI | InChI=1S/C10H17N3O6S/c11-6(10(17)18)1-2-8(15)13-7(3-20)9(16)12-4-19-5-14/h5-7,20H,1-4,11H2,(H,12,16)(H,13,15)(H,17,18)/t6-,7-/m1/s1 |
| InChIKey | ULMYAZWSQXNXRF-RNFRBKRXSA-N |
| XLogP | -2.16 |
| TPSA | 147.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|