C24H32O12 — CID 162145810
3-(4-methyl-5-methylidene-2-oxo-1,3-dioxolan-4-yl)propyl formate;3-(4-methyl-5-methylidene-2-oxo-1,3-dioxolan-4-yl)propyl prop-2-enoate;methyl prop-2-enoate (PubChem CID 162145810) has the molecular formula C24H32O12 and a molecular weight of 512.51 g/mol. Its IUPAC name is 3-(4-methyl-5-methylidene-2-oxo-1,3-dioxolan-4-yl)propyl formate;3-(4-methyl-5-methylidene-2-oxo-1,3-dioxolan-4-yl)propyl prop-2-enoate;methyl prop-2-enoate.
| Compound Name | 3-(4-methyl-5-methylidene-2-oxo-1,3-dioxolan-4-yl)propyl formate;3-(4-methyl-5-methylidene-2-oxo-1,3-dioxolan-4-yl)propyl prop-2-enoate;methyl prop-2-enoate |
|---|---|
| PubChem CID | 162145810 |
| Molecular Formula | C24H32O12 |
| Molecular Weight | 512.51 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | 3-(4-methyl-5-methylidene-2-oxo-1,3-dioxolan-4-yl)propyl formate;3-(4-methyl-5-methylidene-2-oxo-1,3-dioxolan-4-yl)propyl prop-2-enoate;methyl prop-2-enoate |
| SMILES | C=C1OC(=O)OC1(C)CCCOC=O.C=CC(=O)OC.C=CC(=O)OCCCC1(C)OC(=O)OC1=C |
| InChI | InChI=1S/C11H14O5.C9H12O5.C4H6O2/c1-4-9(12)14-7-5-6-11(3)8(2)15-10(13)16-11;1-7-9(2,14-8(11)13-7)4-3-5-12-6-10;1-3-4(5)6-2/h4H,1-2,5-7H2,3H3;6H,1,3-5H2,2H3;3H,1H2,2H3 |
| InChIKey | ZKNQOWPHBJIQIS-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|