C38H44F6O8S4 — CID 162156749
dibenzyl(4-dibenzylsulfoniobutyl)sulfanium;bis(1,1,2-trifluoro-3-hydroxypropane-1-sulfonate) (PubChem CID 162156749) has the molecular formula C38H44F6O8S4 and a molecular weight of 871.02 g/mol. Its IUPAC name is dibenzyl(4-dibenzylsulfoniobutyl)sulfanium;bis(1,1,2-trifluoro-3-hydroxypropane-1-sulfonate).
| Compound Name | dibenzyl(4-dibenzylsulfoniobutyl)sulfanium;bis(1,1,2-trifluoro-3-hydroxypropane-1-sulfonate) |
|---|---|
| PubChem CID | 162156749 |
| Molecular Formula | C38H44F6O8S4 |
| Molecular Weight | 871.02 g/mol |
| Exact Mass | 870.18 |
| IUPAC Name | dibenzyl(4-dibenzylsulfoniobutyl)sulfanium;bis(1,1,2-trifluoro-3-hydroxypropane-1-sulfonate) |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)CO.O=S(=O)([O-])C(F)(F)C(F)CO.c1ccc(C[S+](CCCC[S+](Cc2ccccc2)Cc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C32H36S2.2C3H5F3O4S/c1-5-15-29(16-6-1)25-33(26-30-17-7-2-8-18-30)23-13-14-24-34(27-31-19-9-3-10-20-31)28-32-21-11-4-12-22-32;2*4-2(1-7)3(5,6)11(8,9)10/h1-12,15-22H,13-14,23-28H2;2*2,7H,1H2,(H,8,9,10)/q+2;;/p-2 |
| InChIKey | ZLXVFZKGMWZZKG-UHFFFAOYSA-L |
| XLogP | 6.71 |
| TPSA | 154.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.02 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|