C23H27F2N3O5 — CID 162170932
7-[3-(2,4-difluorophenyl)propanoyl]-5-hydroxy-1-methyl-3-(3-propan-2-yloxypropyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 162170932) has the molecular formula C23H27F2N3O5 and a molecular weight of 463.48 g/mol. Its IUPAC name is 7-[3-(2,4-difluorophenyl)propanoyl]-5-hydroxy-1-methyl-3-(3-propan-2-yloxypropyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | 7-[3-(2,4-difluorophenyl)propanoyl]-5-hydroxy-1-methyl-3-(3-propan-2-yloxypropyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 162170932 |
| Molecular Formula | C23H27F2N3O5 |
| Molecular Weight | 463.48 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 7-[3-(2,4-difluorophenyl)propanoyl]-5-hydroxy-1-methyl-3-(3-propan-2-yloxypropyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | CC(C)OCCCN1CN(C)n2cc(C(=O)CCc3ccc(F)cc3F)c(=O)c(O)c2C1=O |
| InChI | InChI=1S/C23H27F2N3O5/c1-14(2)33-10-4-9-27-13-26(3)28-12-17(21(30)22(31)20(28)23(27)32)19(29)8-6-15-5-7-16(24)11-18(15)25/h5,7,11-12,14,31H,4,6,8-10,13H2,1-3H3 |
| InChIKey | ZNTVJDRUXYULPU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.48 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|