C27H29F2N3O5S — CID 160890738
7-[3-(2,4-difluorophenyl)propanoyl]-5-hydroxy-3-(3-propan-2-yloxypropyl)-1-(thiophen-3-ylmethyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 160890738) has the molecular formula C27H29F2N3O5S and a molecular weight of 545.61 g/mol. Its IUPAC name is 7-[3-(2,4-difluorophenyl)propanoyl]-5-hydroxy-3-(3-propan-2-yloxypropyl)-1-(thiophen-3-ylmethyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | 7-[3-(2,4-difluorophenyl)propanoyl]-5-hydroxy-3-(3-propan-2-yloxypropyl)-1-(thiophen-3-ylmethyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 160890738 |
| Molecular Formula | C27H29F2N3O5S |
| Molecular Weight | 545.61 g/mol |
| Exact Mass | 545.18 |
| IUPAC Name | 7-[3-(2,4-difluorophenyl)propanoyl]-5-hydroxy-3-(3-propan-2-yloxypropyl)-1-(thiophen-3-ylmethyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | CC(C)OCCCN1CN(Cc2ccsc2)n2cc(C(=O)CCc3ccc(F)cc3F)c(=O)c(O)c2C1=O |
| InChI | InChI=1S/C27H29F2N3O5S/c1-17(2)37-10-3-9-30-16-31(13-18-8-11-38-15-18)32-14-21(25(34)26(35)24(32)27(30)36)23(33)7-5-19-4-6-20(28)12-22(19)29/h4,6,8,11-12,14-15,17,35H,3,5,7,9-10,13,16H2,1-2H3 |
| InChIKey | WRQDQEBGPQAQGA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.61 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|