C24H23F2N3O5S — CID 147646990
7-[3-(2,4-difluorophenyl)propanoyl]-5-hydroxy-3-(2-methoxyethyl)-1-(thiophen-3-ylmethyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 147646990) has the molecular formula C24H23F2N3O5S and a molecular weight of 503.53 g/mol. Its IUPAC name is 7-[3-(2,4-difluorophenyl)propanoyl]-5-hydroxy-3-(2-methoxyethyl)-1-(thiophen-3-ylmethyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | 7-[3-(2,4-difluorophenyl)propanoyl]-5-hydroxy-3-(2-methoxyethyl)-1-(thiophen-3-ylmethyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 147646990 |
| Molecular Formula | C24H23F2N3O5S |
| Molecular Weight | 503.53 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | 7-[3-(2,4-difluorophenyl)propanoyl]-5-hydroxy-3-(2-methoxyethyl)-1-(thiophen-3-ylmethyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | COCCN1CN(Cc2ccsc2)n2cc(C(=O)CCc3ccc(F)cc3F)c(=O)c(O)c2C1=O |
| InChI | InChI=1S/C24H23F2N3O5S/c1-34-8-7-27-14-28(11-15-6-9-35-13-15)29-12-18(22(31)23(32)21(29)24(27)33)20(30)5-3-16-2-4-17(25)10-19(16)26/h2,4,6,9-10,12-13,32H,3,5,7-8,11,14H2,1H3 |
| InChIKey | GITGJCBJHGQOSQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.53 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |