C26H26F2N4O6 — CID 158844790
7-[3-(2,4-difluorophenyl)propanoyl]-5-hydroxy-1-[(5-methyl-1,2-oxazol-3-yl)methyl]-3-(oxolan-2-ylmethyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 158844790) has the molecular formula C26H26F2N4O6 and a molecular weight of 528.51 g/mol. Its IUPAC name is 7-[3-(2,4-difluorophenyl)propanoyl]-5-hydroxy-1-[(5-methyl-1,2-oxazol-3-yl)methyl]-3-(oxolan-2-ylmethyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | 7-[3-(2,4-difluorophenyl)propanoyl]-5-hydroxy-1-[(5-methyl-1,2-oxazol-3-yl)methyl]-3-(oxolan-2-ylmethyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 158844790 |
| Molecular Formula | C26H26F2N4O6 |
| Molecular Weight | 528.51 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | 7-[3-(2,4-difluorophenyl)propanoyl]-5-hydroxy-1-[(5-methyl-1,2-oxazol-3-yl)methyl]-3-(oxolan-2-ylmethyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | Cc1cc(CN2CN(CC3CCCO3)C(=O)c3c(O)c(=O)c(C(=O)CCc4ccc(F)cc4F)cn32)no1 |
| InChI | InChI=1S/C26H26F2N4O6/c1-15-9-18(29-38-15)11-31-14-30(12-19-3-2-8-37-19)26(36)23-25(35)24(34)20(13-32(23)31)22(33)7-5-16-4-6-17(27)10-21(16)28/h4,6,9-10,13,19,35H,2-3,5,7-8,11-12,14H2,1H3 |
| InChIKey | GQJQALDXTYNGMV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 118.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.51 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |