C25H24F2N4O5 — CID 159068803
7-[3-(2,4-difluorophenyl)propanoyl]-5-hydroxy-3-(2-methoxyethyl)-1-(pyridin-3-ylmethyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 159068803) has the molecular formula C25H24F2N4O5 and a molecular weight of 498.49 g/mol. Its IUPAC name is 7-[3-(2,4-difluorophenyl)propanoyl]-5-hydroxy-3-(2-methoxyethyl)-1-(pyridin-3-ylmethyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | 7-[3-(2,4-difluorophenyl)propanoyl]-5-hydroxy-3-(2-methoxyethyl)-1-(pyridin-3-ylmethyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 159068803 |
| Molecular Formula | C25H24F2N4O5 |
| Molecular Weight | 498.49 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | 7-[3-(2,4-difluorophenyl)propanoyl]-5-hydroxy-3-(2-methoxyethyl)-1-(pyridin-3-ylmethyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | COCCN1CN(Cc2cccnc2)n2cc(C(=O)CCc3ccc(F)cc3F)c(=O)c(O)c2C1=O |
| InChI | InChI=1S/C25H24F2N4O5/c1-36-10-9-29-15-30(13-16-3-2-8-28-12-16)31-14-19(23(33)24(34)22(31)25(29)35)21(32)7-5-17-4-6-18(26)11-20(17)27/h2-4,6,8,11-12,14,34H,5,7,9-10,13,15H2,1H3 |
| InChIKey | JZJQEGYWKGTVAP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.49 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |