C21H25F2N5O5 — CID 67742424
N-[(2,4-difluorophenyl)methyl]-5-hydroxy-3-(2-methoxyethyl)-1-[2-(methylamino)ethyl]-4,6-dioxo-2H-pyrido[2,1-f][1,2,4]triazine-7-carboxamide (PubChem CID 67742424) has the molecular formula C21H25F2N5O5 and a molecular weight of 465.46 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-5-hydroxy-3-(2-methoxyethyl)-1-[2-(methylamino)ethyl]-4,6-dioxo-2H-pyrido[2,1-f][1,2,4]triazine-7-carboxamide.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-5-hydroxy-3-(2-methoxyethyl)-1-[2-(methylamino)ethyl]-4,6-dioxo-2H-pyrido[2,1-f][1,2,4]triazine-7-carboxamide |
|---|---|
| PubChem CID | 67742424 |
| Molecular Formula | C21H25F2N5O5 |
| Molecular Weight | 465.46 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-5-hydroxy-3-(2-methoxyethyl)-1-[2-(methylamino)ethyl]-4,6-dioxo-2H-pyrido[2,1-f][1,2,4]triazine-7-carboxamide |
| SMILES | CNCCN1CN(CCOC)C(=O)c2c(O)c(=O)c(C(=O)NCc3ccc(F)cc3F)cn21 |
| InChI | InChI=1S/C21H25F2N5O5/c1-24-5-6-27-12-26(7-8-33-2)21(32)17-19(30)18(29)15(11-28(17)27)20(31)25-10-13-3-4-14(22)9-16(13)23/h3-4,9,11,24,30H,5-8,10,12H2,1-2H3,(H,25,31) |
| InChIKey | DYMFEUCORKAKLS-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 116.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.46 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |