C24H28F2N4O6 — CID 148971316
N-[2-[7-[3-(2,4-difluorophenyl)propanoyl]-5-hydroxy-3-(2-methoxyethyl)-4,6-dioxo-2H-pyrido[2,1-f][1,2,4]triazin-1-yl]ethyl]-N-methylacetamide (PubChem CID 148971316) has the molecular formula C24H28F2N4O6 and a molecular weight of 506.51 g/mol. Its IUPAC name is N-[2-[7-[3-(2,4-difluorophenyl)propanoyl]-5-hydroxy-3-(2-methoxyethyl)-4,6-dioxo-2H-pyrido[2,1-f][1,2,4]triazin-1-yl]ethyl]-N-methylacetamide.
| Compound Name | N-[2-[7-[3-(2,4-difluorophenyl)propanoyl]-5-hydroxy-3-(2-methoxyethyl)-4,6-dioxo-2H-pyrido[2,1-f][1,2,4]triazin-1-yl]ethyl]-N-methylacetamide |
|---|---|
| PubChem CID | 148971316 |
| Molecular Formula | C24H28F2N4O6 |
| Molecular Weight | 506.51 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | N-[2-[7-[3-(2,4-difluorophenyl)propanoyl]-5-hydroxy-3-(2-methoxyethyl)-4,6-dioxo-2H-pyrido[2,1-f][1,2,4]triazin-1-yl]ethyl]-N-methylacetamide |
| SMILES | COCCN1CN(CCN(C)C(C)=O)n2cc(C(=O)CCc3ccc(F)cc3F)c(=O)c(O)c2C1=O |
| InChI | InChI=1S/C24H28F2N4O6/c1-15(31)27(2)8-9-29-14-28(10-11-36-3)24(35)21-23(34)22(33)18(13-30(21)29)20(32)7-5-16-4-6-17(25)12-19(16)26/h4,6,12-13,34H,5,7-11,14H2,1-3H3 |
| InChIKey | PTXRRFUEJCFVHI-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.51 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |