C30H31BCl2N2 — CID 162171539
CID 162171539 (PubChem CID 162171539) has the molecular formula C30H31BCl2N2 and a molecular weight of 501.31 g/mol.
| Compound Name | CID 162171539 |
|---|---|
| PubChem CID | 162171539 |
| Molecular Formula | C30H31BCl2N2 |
| Molecular Weight | 501.31 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | — |
| SMILES | CCC(C)(C)Cc1cnc(Cc2ccc(Cl)cc2Cl)[nH]1.[B]C=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H20Cl2N2.C14H11B/c1-4-16(2,3)9-13-10-19-15(20-13)7-11-5-6-12(17)8-14(11)18;15-11-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h5-6,8,10H,4,7,9H2,1-3H3,(H,19,20);1-11H |
| InChIKey | RRQWQBZRGJMUJN-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.31 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|