C11H10Cl2N2S — CID 137368675
5-[(2,4-dichlorophenyl)methyl]-2-methylsulfanyl-1H-imidazole (PubChem CID 137368675) has the molecular formula C11H10Cl2N2S and a molecular weight of 273.19 g/mol. Its IUPAC name is 5-[(2,4-dichlorophenyl)methyl]-2-methylsulfanyl-1H-imidazole.
| Compound Name | 5-[(2,4-dichlorophenyl)methyl]-2-methylsulfanyl-1H-imidazole |
|---|---|
| PubChem CID | 137368675 |
| Molecular Formula | C11H10Cl2N2S |
| Molecular Weight | 273.19 g/mol |
| Exact Mass | 271.99 |
| IUPAC Name | 5-[(2,4-dichlorophenyl)methyl]-2-methylsulfanyl-1H-imidazole |
| SMILES | CSc1ncc(Cc2ccc(Cl)cc2Cl)[nH]1 |
| InChI | InChI=1S/C11H10Cl2N2S/c1-16-11-14-6-9(15-11)4-7-2-3-8(12)5-10(7)13/h2-3,5-6H,4H2,1H3,(H,14,15) |
| InChIKey | SYHUNNPIMGLQBY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.19 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |