C18H10N4S2 — CID 162196084
3-isocyano-5,6-bis(phenylsulfanyl)pyrazine-2-carbonitrile (PubChem CID 162196084) has the molecular formula C18H10N4S2 and a molecular weight of 346.44 g/mol. Its IUPAC name is 3-isocyano-5,6-bis(phenylsulfanyl)pyrazine-2-carbonitrile.
| Compound Name | 3-isocyano-5,6-bis(phenylsulfanyl)pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 162196084 |
| Molecular Formula | C18H10N4S2 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 3-isocyano-5,6-bis(phenylsulfanyl)pyrazine-2-carbonitrile |
| SMILES | [C-]#[N+]c1nc(Sc2ccccc2)c(Sc2ccccc2)nc1C#N |
| InChI | InChI=1S/C18H10N4S2/c1-20-16-15(12-19)21-17(23-13-8-4-2-5-9-13)18(22-16)24-14-10-6-3-7-11-14/h2-11H |
| InChIKey | PTALGROCYHPNLJ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 53.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|