About [diethyl(methyl)silyl] 2-[bis[(2,2,2-trichloroacetyl)oxy]methyl]benzoate
[diethyl(methyl)silyl] 2-[bis[(2,2,2-trichloroacetyl)oxy]methyl]benzoate (PubChem CID 162196818) has the molecular formula C17H18Cl6O6Si
and a molecular weight of 559.13 g/mol. Its IUPAC name is [diethyl(methyl)silyl] 2-[bis[(2,2,2-trichloroacetyl)oxy]methyl]benzoate.
Molecular Properties
| Compound Name | [diethyl(methyl)silyl] 2-[bis[(2,2,2-trichloroacetyl)oxy]methyl]benzoate |
| PubChem CID | 162196818 |
| Molecular Formula | C17H18Cl6O6Si |
| Molecular Weight | 559.13 g/mol |
| Exact Mass | 555.90 |
| IUPAC Name | [diethyl(methyl)silyl] 2-[bis[(2,2,2-trichloroacetyl)oxy]methyl]benzoate |
| SMILES | CC[Si](C)(CC)OC(=O)c1ccccc1C(OC(=O)C(Cl)(Cl)Cl)OC(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H18Cl6O6Si/c1-4-30(3,5-2)29-12(24)10-8-6-7-9-11(10)13(27-14(25)16(18,19)20)28-15(26)17(21,22)23/h6-9,13H,4-5H2,1-3H3 |
| InChIKey | HYXZSBHCBBWJAM-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 559.13 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [diethyl(methyl)silyl] 2-[bis[(2,2,2-trichloroacetyl)oxy]methyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [diethyl(methyl)silyl] 2-[bis[(2,2,2-trichloroacetyl)oxy]methyl]benzoate?
The IUPAC name of [diethyl(methyl)silyl] 2-[bis[(2,2,2-trichloroacetyl)oxy]methyl]benzoate (CID 162196818) is [diethyl(methyl)silyl] 2-[bis[(2,2,2-trichloroacetyl)oxy]methyl]benzoate.
What is the SMILES notation for [diethyl(methyl)silyl] 2-[bis[(2,2,2-trichloroacetyl)oxy]methyl]benzoate?
The canonical SMILES for [diethyl(methyl)silyl] 2-[bis[(2,2,2-trichloroacetyl)oxy]methyl]benzoate is CC[Si](C)(CC)OC(=O)c1ccccc1C(OC(=O)C(Cl)(Cl)Cl)OC(=O)C(Cl)(Cl)Cl.
What is the InChIKey of [diethyl(methyl)silyl] 2-[bis[(2,2,2-trichloroacetyl)oxy]methyl]benzoate?
The InChIKey is HYXZSBHCBBWJAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18Cl6O6Si/c1-4-30(3,5-2)29-12(24)10-8-6-7-9-11(10)13(27-14(25)16(18,19)20)28-15(26)17(21,22)23/h6-9,13H,4-5H2,1-3H3.
What are the key properties of [diethyl(methyl)silyl] 2-[bis[(2,2,2-trichloroacetyl)oxy]methyl]benzoate?
[diethyl(methyl)silyl] 2-[bis[(2,2,2-trichloroacetyl)oxy]methyl]benzoate has a molecular weight of 559.13 g/mol, XLogP of 6.28, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [diethyl(methyl)silyl] 2-[bis[(2,2,2-trichloroacetyl)oxy]methyl]benzoate is sourced from PubChem (CID 162196818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).