C24H26O9S — CID 162197583
4-acetylbenzoic acid;tert-butyl 4-(2,2-dioxooxathiolane-3-carbonyl)benzoate (PubChem CID 162197583) has the molecular formula C24H26O9S and a molecular weight of 490.53 g/mol. Its IUPAC name is 4-acetylbenzoic acid;tert-butyl 4-(2,2-dioxooxathiolane-3-carbonyl)benzoate.
| Compound Name | 4-acetylbenzoic acid;tert-butyl 4-(2,2-dioxooxathiolane-3-carbonyl)benzoate |
|---|---|
| PubChem CID | 162197583 |
| Molecular Formula | C24H26O9S |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | 4-acetylbenzoic acid;tert-butyl 4-(2,2-dioxooxathiolane-3-carbonyl)benzoate |
| SMILES | CC(=O)c1ccc(C(=O)O)cc1.CC(C)(C)OC(=O)c1ccc(C(=O)C2CCOS2(=O)=O)cc1 |
| InChI | InChI=1S/C15H18O6S.C9H8O3/c1-15(2,3)21-14(17)11-6-4-10(5-7-11)13(16)12-8-9-20-22(12,18)19;1-6(10)7-2-4-8(5-3-7)9(11)12/h4-7,12H,8-9H2,1-3H3;2-5H,1H3,(H,11,12) |
| InChIKey | ZRDQFDRXNAQRFR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 141.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|