C11H14F4O6S — CID 118424046
tert-butyl 4-(2,2-dioxooxathiolan-3-yl)-2,2,3,3-tetrafluoro-4-oxobutanoate (PubChem CID 118424046) has the molecular formula C11H14F4O6S and a molecular weight of 350.29 g/mol. Its IUPAC name is tert-butyl 4-(2,2-dioxooxathiolan-3-yl)-2,2,3,3-tetrafluoro-4-oxobutanoate.
| Compound Name | tert-butyl 4-(2,2-dioxooxathiolan-3-yl)-2,2,3,3-tetrafluoro-4-oxobutanoate |
|---|---|
| PubChem CID | 118424046 |
| Molecular Formula | C11H14F4O6S |
| Molecular Weight | 350.29 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | tert-butyl 4-(2,2-dioxooxathiolan-3-yl)-2,2,3,3-tetrafluoro-4-oxobutanoate |
| SMILES | CC(C)(C)OC(=O)C(F)(F)C(F)(F)C(=O)C1CCOS1(=O)=O |
| InChI | InChI=1S/C11H14F4O6S/c1-9(2,3)21-8(17)11(14,15)10(12,13)7(16)6-4-5-20-22(6,18)19/h6H,4-5H2,1-3H3 |
| InChIKey | LMRJVFYNBZVTMD-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.29 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|