About (2,2-dioxooxathiolan-3-yl) 2,2-dimethylpropanoate
(2,2-dioxooxathiolan-3-yl) 2,2-dimethylpropanoate (PubChem CID 90002320) has the molecular formula C8H14O5S
and a molecular weight of 222.26 g/mol. Its IUPAC name is (2,2-dioxooxathiolan-3-yl) 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | (2,2-dioxooxathiolan-3-yl) 2,2-dimethylpropanoate |
| PubChem CID | 90002320 |
| Molecular Formula | C8H14O5S |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | (2,2-dioxooxathiolan-3-yl) 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC1CCOS1(=O)=O |
| InChI | InChI=1S/C8H14O5S/c1-8(2,3)7(9)13-6-4-5-12-14(6,10)11/h6H,4-5H2,1-3H3 |
| InChIKey | PEMICTFRNWPDBQ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (2,2-dioxooxathiolan-3-yl) 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-dioxooxathiolan-3-yl) 2,2-dimethylpropanoate?
The IUPAC name of (2,2-dioxooxathiolan-3-yl) 2,2-dimethylpropanoate (CID 90002320) is (2,2-dioxooxathiolan-3-yl) 2,2-dimethylpropanoate.
What is the SMILES notation for (2,2-dioxooxathiolan-3-yl) 2,2-dimethylpropanoate?
The canonical SMILES for (2,2-dioxooxathiolan-3-yl) 2,2-dimethylpropanoate is CC(C)(C)C(=O)OC1CCOS1(=O)=O.
What is the InChIKey of (2,2-dioxooxathiolan-3-yl) 2,2-dimethylpropanoate?
The InChIKey is PEMICTFRNWPDBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O5S/c1-8(2,3)7(9)13-6-4-5-12-14(6,10)11/h6H,4-5H2,1-3H3.
What are the key properties of (2,2-dioxooxathiolan-3-yl) 2,2-dimethylpropanoate?
(2,2-dioxooxathiolan-3-yl) 2,2-dimethylpropanoate has a molecular weight of 222.26 g/mol, XLogP of 0.65, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-dioxooxathiolan-3-yl) 2,2-dimethylpropanoate is sourced from PubChem (CID 90002320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).