About 3,3-dimethylbutan-2-one;2-(2-methoxypropanoyloxy)acetic acid
3,3-dimethylbutan-2-one;2-(2-methoxypropanoyloxy)acetic acid (PubChem CID 162206805) has the molecular formula C12H22O6
and a molecular weight of 262.30 g/mol. Its IUPAC name is 3,3-dimethylbutan-2-one;2-(2-methoxypropanoyloxy)acetic acid.
Analyze 3,3-dimethylbutan-2-one;2-(2-methoxypropanoyloxy)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethylbutan-2-one;2-(2-methoxypropanoyloxy)acetic acid?
The IUPAC name of 3,3-dimethylbutan-2-one;2-(2-methoxypropanoyloxy)acetic acid (CID 162206805) is 3,3-dimethylbutan-2-one;2-(2-methoxypropanoyloxy)acetic acid.
What is the SMILES notation for 3,3-dimethylbutan-2-one;2-(2-methoxypropanoyloxy)acetic acid?
The canonical SMILES for 3,3-dimethylbutan-2-one;2-(2-methoxypropanoyloxy)acetic acid is CC(=O)C(C)(C)C.COC(C)C(=O)OCC(=O)O.
What is the InChIKey of 3,3-dimethylbutan-2-one;2-(2-methoxypropanoyloxy)acetic acid?
The InChIKey is ZSHLJUHOPYJIBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O5.C6H12O/c1-4(10-2)6(9)11-3-5(7)8;1-5(7)6(2,3)4/h4H,3H2,1-2H3,(H,7,8);1-4H3.
What are the key properties of 3,3-dimethylbutan-2-one;2-(2-methoxypropanoyloxy)acetic acid?
3,3-dimethylbutan-2-one;2-(2-methoxypropanoyloxy)acetic acid has a molecular weight of 262.30 g/mol, XLogP of 1.27, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethylbutan-2-one;2-(2-methoxypropanoyloxy)acetic acid is sourced from PubChem (CID 162206805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).