C11H18O9 — CID 160871325
2-(2-hydroxypropanoyloxy)acetic acid;2-oxopropyl 2-hydroxypropanoate (PubChem CID 160871325) has the molecular formula C11H18O9 and a molecular weight of 294.26 g/mol. Its IUPAC name is 2-(2-hydroxypropanoyloxy)acetic acid;2-oxopropyl 2-hydroxypropanoate.
| Compound Name | 2-(2-hydroxypropanoyloxy)acetic acid;2-oxopropyl 2-hydroxypropanoate |
|---|---|
| PubChem CID | 160871325 |
| Molecular Formula | C11H18O9 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-(2-hydroxypropanoyloxy)acetic acid;2-oxopropyl 2-hydroxypropanoate |
| SMILES | CC(=O)COC(=O)C(C)O.CC(O)C(=O)OCC(=O)O |
| InChI | InChI=1S/C6H10O4.C5H8O5/c1-4(7)3-10-6(9)5(2)8;1-3(6)5(9)10-2-4(7)8/h5,8H,3H2,1-2H3;3,6H,2H2,1H3,(H,7,8) |
| InChIKey | SLUKDYZOIQLIEK-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |