About methane;pentan-3-ylhydrazine
methane;pentan-3-ylhydrazine (PubChem CID 162238675) has the molecular formula C6H18N2
and a molecular weight of 118.22 g/mol. Its IUPAC name is methane;pentan-3-ylhydrazine.
Molecular Properties
| Compound Name | methane;pentan-3-ylhydrazine |
| PubChem CID | 162238675 |
| Molecular Formula | C6H18N2 |
| Molecular Weight | 118.22 g/mol |
| Exact Mass | 118.15 |
| IUPAC Name | methane;pentan-3-ylhydrazine |
| SMILES | C.CCC(CC)NN |
| InChI | InChI=1S/C5H14N2.CH4/c1-3-5(4-2)7-6;/h5,7H,3-4,6H2,1-2H3;1H4 |
| InChIKey | ZWKGSRAQSFIHQL-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.22 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methane;pentan-3-ylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;pentan-3-ylhydrazine?
The IUPAC name of methane;pentan-3-ylhydrazine (CID 162238675) is methane;pentan-3-ylhydrazine.
What is the SMILES notation for methane;pentan-3-ylhydrazine?
The canonical SMILES for methane;pentan-3-ylhydrazine is C.CCC(CC)NN.
What is the InChIKey of methane;pentan-3-ylhydrazine?
The InChIKey is ZWKGSRAQSFIHQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14N2.CH4/c1-3-5(4-2)7-6;/h5,7H,3-4,6H2,1-2H3;1H4.
What are the key properties of methane;pentan-3-ylhydrazine?
methane;pentan-3-ylhydrazine has a molecular weight of 118.22 g/mol, XLogP of 1.27, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;pentan-3-ylhydrazine is sourced from PubChem (CID 162238675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).