C17H12ClF5N2S2 — CID 162243718
5-chloro-4-[2-[4-(1,1,2,2,2-pentafluoroethylsulfanyl)phenyl]propyl]thieno[2,3-d]pyrimidine (PubChem CID 162243718) has the molecular formula C17H12ClF5N2S2 and a molecular weight of 438.87 g/mol. Its IUPAC name is 5-chloro-4-[2-[4-(1,1,2,2,2-pentafluoroethylsulfanyl)phenyl]propyl]thieno[2,3-d]pyrimidine.
| Compound Name | 5-chloro-4-[2-[4-(1,1,2,2,2-pentafluoroethylsulfanyl)phenyl]propyl]thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 162243718 |
| Molecular Formula | C17H12ClF5N2S2 |
| Molecular Weight | 438.87 g/mol |
| Exact Mass | 438.01 |
| IUPAC Name | 5-chloro-4-[2-[4-(1,1,2,2,2-pentafluoroethylsulfanyl)phenyl]propyl]thieno[2,3-d]pyrimidine |
| SMILES | CC(Cc1ncnc2scc(Cl)c12)c1ccc(SC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H12ClF5N2S2/c1-9(6-13-14-12(18)7-26-15(14)25-8-24-13)10-2-4-11(5-3-10)27-17(22,23)16(19,20)21/h2-5,7-9H,6H2,1H3 |
| InChIKey | ZXAWEOGPWUWKAE-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.87 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|