C15H26N6O3S — CID 162249494
N-[[1-[2-[(5-amino-6-oxoheptyl)amino]-2-oxoethyl]triazol-4-yl]methyl]-3-sulfanylpropanamide (PubChem CID 162249494) has the molecular formula C15H26N6O3S and a molecular weight of 370.48 g/mol. Its IUPAC name is N-[[1-[2-[(5-amino-6-oxoheptyl)amino]-2-oxoethyl]triazol-4-yl]methyl]-3-sulfanylpropanamide.
| Compound Name | N-[[1-[2-[(5-amino-6-oxoheptyl)amino]-2-oxoethyl]triazol-4-yl]methyl]-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 162249494 |
| Molecular Formula | C15H26N6O3S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | N-[[1-[2-[(5-amino-6-oxoheptyl)amino]-2-oxoethyl]triazol-4-yl]methyl]-3-sulfanylpropanamide |
| SMILES | CC(=O)C(N)CCCCNC(=O)Cn1cc(CNC(=O)CCS)nn1 |
| InChI | InChI=1S/C15H26N6O3S/c1-11(22)13(16)4-2-3-6-17-15(24)10-21-9-12(19-20-21)8-18-14(23)5-7-25/h9,13,25H,2-8,10,16H2,1H3,(H,17,24)(H,18,23) |
| InChIKey | ZXUILEYCAHBHPW-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 132.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|