C12H15F3NO7S2- — CID 162251579
[4-[N-hydroxy-C-(trifluoromethyl)carbonimidoyl]phenyl] methanesulfonate;propyl sulfite (PubChem CID 162251579) has the molecular formula C12H15F3NO7S2- and a molecular weight of 406.38 g/mol. Its IUPAC name is [4-[N-hydroxy-C-(trifluoromethyl)carbonimidoyl]phenyl] methanesulfonate;propyl sulfite.
| Compound Name | [4-[N-hydroxy-C-(trifluoromethyl)carbonimidoyl]phenyl] methanesulfonate;propyl sulfite |
|---|---|
| PubChem CID | 162251579 |
| Molecular Formula | C12H15F3NO7S2- |
| Molecular Weight | 406.38 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | [4-[N-hydroxy-C-(trifluoromethyl)carbonimidoyl]phenyl] methanesulfonate;propyl sulfite |
| SMILES | CCCOS(=O)[O-].CS(=O)(=O)Oc1ccc(C(=NO)C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H8F3NO4S.C3H8O3S/c1-18(15,16)17-7-4-2-6(3-5-7)8(13-14)9(10,11)12;1-2-3-6-7(4)5/h2-5,14H,1H3;2-3H2,1H3,(H,4,5)/p-1 |
| InChIKey | KDUKSLNJACWSKB-UHFFFAOYSA-M |
| XLogP | 1.97 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|