C36H42Cl4N2O8 — CID 162253720
3-(2,4-dichlorophenyl)-4-hydroxy-5,5,6,6-tetramethylpyran-2-one;[5-(2,4-dichlorophenyl)-2,2,3,3-tetramethyl-6-oxopyran-4-yl] N-ethylcarbamate;isocyanatoethane (PubChem CID 162253720) has the molecular formula C36H42Cl4N2O8 and a molecular weight of 772.55 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-4-hydroxy-5,5,6,6-tetramethylpyran-2-one;[5-(2,4-dichlorophenyl)-2,2,3,3-tetramethyl-6-oxopyran-4-yl] N-ethylcarbamate;isocyanatoethane.
| Compound Name | 3-(2,4-dichlorophenyl)-4-hydroxy-5,5,6,6-tetramethylpyran-2-one;[5-(2,4-dichlorophenyl)-2,2,3,3-tetramethyl-6-oxopyran-4-yl] N-ethylcarbamate;isocyanatoethane |
|---|---|
| PubChem CID | 162253720 |
| Molecular Formula | C36H42Cl4N2O8 |
| Molecular Weight | 772.55 g/mol |
| Exact Mass | 770.17 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-4-hydroxy-5,5,6,6-tetramethylpyran-2-one;[5-(2,4-dichlorophenyl)-2,2,3,3-tetramethyl-6-oxopyran-4-yl] N-ethylcarbamate;isocyanatoethane |
| SMILES | CC1(C)OC(=O)C(c2ccc(Cl)cc2Cl)=C(O)C1(C)C.CCN=C=O.CCNC(=O)OC1=C(c2ccc(Cl)cc2Cl)C(=O)OC(C)(C)C1(C)C |
| InChI | InChI=1S/C18H21Cl2NO4.C15H16Cl2O3.C3H5NO/c1-6-21-16(23)24-14-13(11-8-7-10(19)9-12(11)20)15(22)25-18(4,5)17(14,2)3;1-14(2)12(18)11(13(19)20-15(14,3)4)9-6-5-8(16)7-10(9)17;1-2-4-3-5/h7-9H,6H2,1-5H3,(H,21,23);5-7,18H,1-4H3;2H2,1H3 |
| InChIKey | ZYIABRAFYMBVGX-UHFFFAOYSA-N |
| XLogP | 9.78 |
| TPSA | 140.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.55 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|