C13H8F6N2O3 — CID 162260452
1,1,1,4,4,4-hexafluorobutane-2,3-dione;N-(4-isocyanophenyl)acetamide (PubChem CID 162260452) has the molecular formula C13H8F6N2O3 and a molecular weight of 354.21 g/mol. Its IUPAC name is 1,1,1,4,4,4-hexafluorobutane-2,3-dione;N-(4-isocyanophenyl)acetamide.
| Compound Name | 1,1,1,4,4,4-hexafluorobutane-2,3-dione;N-(4-isocyanophenyl)acetamide |
|---|---|
| PubChem CID | 162260452 |
| Molecular Formula | C13H8F6N2O3 |
| Molecular Weight | 354.21 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 1,1,1,4,4,4-hexafluorobutane-2,3-dione;N-(4-isocyanophenyl)acetamide |
| SMILES | O=C(C(=O)C(F)(F)F)C(F)(F)F.[C-]#[N+]c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C9H8N2O.C4F6O2/c1-7(12)11-9-5-3-8(10-2)4-6-9;5-3(6,7)1(11)2(12)4(8,9)10/h3-6H,1H3,(H,11,12); |
| InChIKey | ZZEHIYKEOQVKGU-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.21 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|