C14H16N+ — CID 162268108
1-methyl-2-(4-methyl-3-bicyclo[4.1.0]hepta-2,4-dienyl)pyridin-1-ium (PubChem CID 162268108) has the molecular formula C14H16N+ and a molecular weight of 198.29 g/mol. Its IUPAC name is 1-methyl-2-(4-methyl-3-bicyclo[4.1.0]hepta-2,4-dienyl)pyridin-1-ium.
| Compound Name | 1-methyl-2-(4-methyl-3-bicyclo[4.1.0]hepta-2,4-dienyl)pyridin-1-ium |
|---|---|
| PubChem CID | 162268108 |
| Molecular Formula | C14H16N+ |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 1-methyl-2-(4-methyl-3-bicyclo[4.1.0]hepta-2,4-dienyl)pyridin-1-ium |
| SMILES | CC1=CC2CC2C=C1c1cccc[n+]1C |
| InChI | InChI=1S/C14H16N/c1-10-7-11-8-12(11)9-13(10)14-5-3-4-6-15(14)2/h3-7,9,11-12H,8H2,1-2H3/q+1 |
| InChIKey | LAYZWWONVRKWQZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|