C16H16NO+ — CID 162283141
1-methyl-2-(3-methyl-1a,6b-dihydro-1H-cyclopropa[b][1]benzofuran-4-yl)pyridin-1-ium (PubChem CID 162283141) has the molecular formula C16H16NO+ and a molecular weight of 238.31 g/mol. Its IUPAC name is 1-methyl-2-(3-methyl-1a,6b-dihydro-1H-cyclopropa[b][1]benzofuran-4-yl)pyridin-1-ium.
| Compound Name | 1-methyl-2-(3-methyl-1a,6b-dihydro-1H-cyclopropa[b][1]benzofuran-4-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 162283141 |
| Molecular Formula | C16H16NO+ |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 1-methyl-2-(3-methyl-1a,6b-dihydro-1H-cyclopropa[b][1]benzofuran-4-yl)pyridin-1-ium |
| SMILES | Cc1c(-c2cccc[n+]2C)ccc2c1OC1CC21 |
| InChI | InChI=1S/C16H16NO/c1-10-11(14-5-3-4-8-17(14)2)6-7-12-13-9-15(13)18-16(10)12/h3-8,13,15H,9H2,1-2H3/q+1 |
| InChIKey | JQDHTEQUTYUPMX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|