C14H33N5 — CID 162281630
2-N,2-N'-diethyl-2-N,2-N',1,3,6-pentamethyl-1,3,6-triazocane-2,2-diamine (PubChem CID 162281630) has the molecular formula C14H33N5 and a molecular weight of 271.45 g/mol. Its IUPAC name is 2-N,2-N'-diethyl-2-N,2-N',1,3,6-pentamethyl-1,3,6-triazocane-2,2-diamine.
| Compound Name | 2-N,2-N'-diethyl-2-N,2-N',1,3,6-pentamethyl-1,3,6-triazocane-2,2-diamine |
|---|---|
| PubChem CID | 162281630 |
| Molecular Formula | C14H33N5 |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.27 |
| IUPAC Name | 2-N,2-N'-diethyl-2-N,2-N',1,3,6-pentamethyl-1,3,6-triazocane-2,2-diamine |
| SMILES | CCN(C)C1(N(C)CC)N(C)CCN(C)CCN1C |
| InChI | InChI=1S/C14H33N5/c1-8-16(4)14(17(5)9-2)18(6)12-10-15(3)11-13-19(14)7/h8-13H2,1-7H3 |
| InChIKey | GOBUYKLVXVXRPK-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 16.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|